C15H20ClN5O — CID 129483018
(3S)-1-(3-chloro-4-pyridinyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol (PubChem CID 129483018) has the molecular formula C15H20ClN5O and a molecular weight of 321.81 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-pyridinyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol.
| Compound Name | (3S)-1-(3-chloro-4-pyridinyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 129483018 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (3S)-1-(3-chloro-4-pyridinyl)-3-(1-propan-2-yltriazol-4-yl)piperidin-3-ol |
| SMILES | CC(C)n1cc([C@]2(O)CCCN(c3ccncc3Cl)C2)nn1 |
| InChI | InChI=1S/C15H20ClN5O/c1-11(2)21-9-14(18-19-21)15(22)5-3-7-20(10-15)13-4-6-17-8-12(13)16/h4,6,8-9,11,22H,3,5,7,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | PAGVJRNIBCAYKW-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |