C19H21N3O3 — CID 129485829
(3S)-3-hydroxy-1-[5-(3-methylphenyl)pyridine-3-carbonyl]piperidine-3-carboxamide (PubChem CID 129485829) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (3S)-3-hydroxy-1-[5-(3-methylphenyl)pyridine-3-carbonyl]piperidine-3-carboxamide.
| Compound Name | (3S)-3-hydroxy-1-[5-(3-methylphenyl)pyridine-3-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 129485829 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (3S)-3-hydroxy-1-[5-(3-methylphenyl)pyridine-3-carbonyl]piperidine-3-carboxamide |
| SMILES | Cc1cccc(-c2cncc(C(=O)N3CCC[C@@](O)(C(N)=O)C3)c2)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-13-4-2-5-14(8-13)15-9-16(11-21-10-15)17(23)22-7-3-6-19(25,12-22)18(20)24/h2,4-5,8-11,25H,3,6-7,12H2,1H3,(H2,20,24)/t19-/m0/s1 |
| InChIKey | MMXBMELFKAVGNG-IBGZPJMESA-N |
| XLogP | 1.51 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |