C11H18FN3 — CID 129488138
(3R)-3-fluoro-3-methyl-1-[(1-methylimidazol-2-yl)methyl]piperidine (PubChem CID 129488138) has the molecular formula C11H18FN3 and a molecular weight of 211.28 g/mol. Its IUPAC name is (3R)-3-fluoro-3-methyl-1-[(1-methylimidazol-2-yl)methyl]piperidine.
| Compound Name | (3R)-3-fluoro-3-methyl-1-[(1-methylimidazol-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 129488138 |
| Molecular Formula | C11H18FN3 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | (3R)-3-fluoro-3-methyl-1-[(1-methylimidazol-2-yl)methyl]piperidine |
| SMILES | Cn1ccnc1CN1CCC[C@@](C)(F)C1 |
| InChI | InChI=1S/C11H18FN3/c1-11(12)4-3-6-15(9-11)8-10-13-5-7-14(10)2/h5,7H,3-4,6,8-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | NOWFKDXFCJYFNF-LLVKDONJSA-N |
| XLogP | 1.74 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |