C12H18FN3 — CID 129488024
4-[[(3R)-3-fluoro-3-methylpiperidin-1-yl]methyl]-6-methylpyrimidine (PubChem CID 129488024) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 4-[[(3R)-3-fluoro-3-methylpiperidin-1-yl]methyl]-6-methylpyrimidine.
| Compound Name | 4-[[(3R)-3-fluoro-3-methylpiperidin-1-yl]methyl]-6-methylpyrimidine |
|---|---|
| PubChem CID | 129488024 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 4-[[(3R)-3-fluoro-3-methylpiperidin-1-yl]methyl]-6-methylpyrimidine |
| SMILES | Cc1cc(CN2CCC[C@@](C)(F)C2)ncn1 |
| InChI | InChI=1S/C12H18FN3/c1-10-6-11(15-9-14-10)7-16-5-3-4-12(2,13)8-16/h6,9H,3-5,7-8H2,1-2H3/t12-/m1/s1 |
| InChIKey | FOTXSTUTDLZDFK-GFCCVEGCSA-N |
| XLogP | 2.11 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |