C11H15F2N3 — CID 168939087
2-[(3,3-difluoropiperidin-1-yl)methyl]-5-methylpyrimidine (PubChem CID 168939087) has the molecular formula C11H15F2N3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[(3,3-difluoropiperidin-1-yl)methyl]-5-methylpyrimidine.
| Compound Name | 2-[(3,3-difluoropiperidin-1-yl)methyl]-5-methylpyrimidine |
|---|---|
| PubChem CID | 168939087 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[(3,3-difluoropiperidin-1-yl)methyl]-5-methylpyrimidine |
| SMILES | Cc1cnc(CN2CCCC(F)(F)C2)nc1 |
| InChI | InChI=1S/C11H15F2N3/c1-9-5-14-10(15-6-9)7-16-4-2-3-11(12,13)8-16/h5-6H,2-4,7-8H2,1H3 |
| InChIKey | VANPMTUSUAZMMC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |