About ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole
ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole (PubChem CID 143819268) has the molecular formula C13H26F2N4
and a molecular weight of 276.38 g/mol. Its IUPAC name is ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole.
Molecular Properties
| Compound Name | ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole |
| PubChem CID | 143819268 |
| Molecular Formula | C13H26F2N4 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole |
| SMILES | CC.CCN1CCCC(F)(F)C1.CCn1nccn1 |
| InChI | InChI=1S/C7H13F2N.C4H7N3.C2H6/c1-2-10-5-3-4-7(8,9)6-10;1-2-7-5-3-4-6-7;1-2/h2-6H2,1H3;3-4H,2H2,1H3;1-2H3 |
| InChIKey | TXJHMIFJDKBQKO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole?
The IUPAC name of ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole (CID 143819268) is ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole.
What is the SMILES notation for ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole?
The canonical SMILES for ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole is CC.CCN1CCCC(F)(F)C1.CCn1nccn1.
What is the InChIKey of ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole?
The InChIKey is TXJHMIFJDKBQKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2N.C4H7N3.C2H6/c1-2-10-5-3-4-7(8,9)6-10;1-2-7-5-3-4-6-7;1-2/h2-6H2,1H3;3-4H,2H2,1H3;1-2H3.
What are the key properties of ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole?
ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole has a molecular weight of 276.38 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3,3-difluoropiperidine;2-ethyltriazole is sourced from PubChem (CID 143819268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).