About 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane
3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane (PubChem CID 143819427) has the molecular formula C14H20F5NS
and a molecular weight of 329.38 g/mol. Its IUPAC name is 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane.
Molecular Properties
| Compound Name | 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane |
| PubChem CID | 143819427 |
| Molecular Formula | C14H20F5NS |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane |
| SMILES | CC.Cc1sc(CN2CCCC(F)(F)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H14F5NS.C2H6/c1-8-10(12(15,16)17)5-9(19-8)6-18-4-2-3-11(13,14)7-18;1-2/h5H,2-4,6-7H2,1H3;1-2H3 |
| InChIKey | LRCGHAFOOAMXMZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane?
The IUPAC name of 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane (CID 143819427) is 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane.
What is the SMILES notation for 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane?
The canonical SMILES for 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane is CC.Cc1sc(CN2CCCC(F)(F)C2)cc1C(F)(F)F.
What is the InChIKey of 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane?
The InChIKey is LRCGHAFOOAMXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F5NS.C2H6/c1-8-10(12(15,16)17)5-9(19-8)6-18-4-2-3-11(13,14)7-18;1-2/h5H,2-4,6-7H2,1H3;1-2H3.
What are the key properties of 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane?
3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane has a molecular weight of 329.38 g/mol, XLogP of 5.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1-[[5-methyl-4-(trifluoromethyl)thiophen-2-yl]methyl]piperidine;ethane is sourced from PubChem (CID 143819427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).