C13H22N6O2S — CID 129488934
(3R)-3-(3-carbamoyl-1,2,4-triazol-1-yl)-N-(3-methylsulfanylpropyl)piperidine-1-carboxamide (PubChem CID 129488934) has the molecular formula C13H22N6O2S and a molecular weight of 326.43 g/mol. Its IUPAC name is (3R)-3-(3-carbamoyl-1,2,4-triazol-1-yl)-N-(3-methylsulfanylpropyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-(3-carbamoyl-1,2,4-triazol-1-yl)-N-(3-methylsulfanylpropyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 129488934 |
| Molecular Formula | C13H22N6O2S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (3R)-3-(3-carbamoyl-1,2,4-triazol-1-yl)-N-(3-methylsulfanylpropyl)piperidine-1-carboxamide |
| SMILES | CSCCCNC(=O)N1CCC[C@@H](n2cnc(C(N)=O)n2)C1 |
| InChI | InChI=1S/C13H22N6O2S/c1-22-7-3-5-15-13(21)18-6-2-4-10(8-18)19-9-16-12(17-19)11(14)20/h9-10H,2-8H2,1H3,(H2,14,20)(H,15,21)/t10-/m1/s1 |
| InChIKey | YSEYBUMQIRIRDT-SNVBAGLBSA-N |
| XLogP | 0.48 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|