C16H23N5O2 — CID 129490005
1-[(3R)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 129490005) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[(3R)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(3R)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 129490005 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-[(3R)-1-[2-(cyclohexen-1-yl)acetyl]piperidin-3-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn([C@@H]2CCCN(C(=O)CC3=CCCCC3)C2)n1 |
| InChI | InChI=1S/C16H23N5O2/c17-15(23)16-18-11-21(19-16)13-7-4-8-20(10-13)14(22)9-12-5-2-1-3-6-12/h5,11,13H,1-4,6-10H2,(H2,17,23)/t13-/m1/s1 |
| InChIKey | MCSVNBLPBGYGRD-CYBMUJFWSA-N |
| XLogP | 1.43 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|