About (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one
(4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one (PubChem CID 129490529) has the molecular formula C17H29N3O3
and a molecular weight of 323.44 g/mol. Its IUPAC name is (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one |
| PubChem CID | 129490529 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one |
| SMILES | CC[C@@H]1CN(C(=O)[C@H]2CCN(C)C(=O)C2)C[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C17H29N3O3/c1-3-13-11-20(12-15(13)19-6-8-23-9-7-19)17(22)14-4-5-18(2)16(21)10-14/h13-15H,3-12H2,1-2H3/t13-,14+,15-/m1/s1 |
| InChIKey | KCFNHNLSFLDWAK-QLFBSQMISA-N |
| XLogP | 0.42 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one?
The IUPAC name of (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one (CID 129490529) is (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one.
What is the SMILES notation for (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one?
The canonical SMILES for (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one is CC[C@@H]1CN(C(=O)[C@H]2CCN(C)C(=O)C2)C[C@H]1N1CCOCC1.
What is the InChIKey of (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one?
The InChIKey is KCFNHNLSFLDWAK-QLFBSQMISA-N. The full InChI is InChI=1S/C17H29N3O3/c1-3-13-11-20(12-15(13)19-6-8-23-9-7-19)17(22)14-4-5-18(2)16(21)10-14/h13-15H,3-12H2,1-2H3/t13-,14+,15-/m1/s1.
What are the key properties of (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one?
(4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one has a molecular weight of 323.44 g/mol, XLogP of 0.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(3R,4S)-3-ethyl-4-morpholin-4-ylpyrrolidine-1-carbonyl]-1-methylpiperidin-2-one is sourced from PubChem (CID 129490529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).