C13H17FN4O3 — CID 129491157
[(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]-morpholin-4-ylmethanone (PubChem CID 129491157) has the molecular formula C13H17FN4O3 and a molecular weight of 296.30 g/mol. Its IUPAC name is [(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 129491157 |
| Molecular Formula | C13H17FN4O3 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1CC[C@H](Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C13H17FN4O3/c14-10-7-15-12(16-8-10)21-11-1-2-18(9-11)13(19)17-3-5-20-6-4-17/h7-8,11H,1-6,9H2/t11-/m0/s1 |
| InChIKey | XVICSYCBTBGERY-NSHDSACASA-N |
| XLogP | 0.52 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |