C13H21N3O4S — CID 129491400
(4aS,8aS)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 129491400) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is (4aS,8aS)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | (4aS,8aS)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 129491400 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (4aS,8aS)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCO[C@H]2CCN(C)C[C@@H]21 |
| InChI | InChI=1S/C13H21N3O4S/c1-9-13(10(2)20-14-9)21(17,18)16-6-7-19-12-4-5-15(3)8-11(12)16/h11-12H,4-8H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | MVEVMYUTIFUNSB-RYUDHWBXSA-N |
| XLogP | 0.39 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |