C16H25N3O7S — CID 163341573
(4aR,6S,8aR)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide;formic acid (PubChem CID 163341573) has the molecular formula C16H25N3O7S and a molecular weight of 403.46 g/mol. Its IUPAC name is (4aR,6S,8aR)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide;formic acid.
| Compound Name | (4aR,6S,8aR)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide;formic acid |
|---|---|
| PubChem CID | 163341573 |
| Molecular Formula | C16H25N3O7S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (4aR,6S,8aR)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-6-carboxamide;formic acid |
| SMILES | CNC(=O)[C@H]1CC[C@H]2OCCN(S(=O)(=O)c3c(C)noc3C)[C@@H]2C1.O=CO |
| InChI | InChI=1S/C15H23N3O5S.CH2O2/c1-9-14(10(2)23-17-9)24(20,21)18-6-7-22-13-5-4-11(8-12(13)18)15(19)16-3;2-1-3/h11-13H,4-8H2,1-3H3,(H,16,19);1H,(H,2,3)/t11-,12+,13+;/m0./s1 |
| InChIKey | TZCPXFHTVNMHJB-LUHWTZLKSA-N |
| XLogP | 0.30 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|