C8H15N3O — CID 129495415
(1S,5S)-6-methoxy-3-azabicyclo[3.1.1]heptane-3-carboximidamide (PubChem CID 129495415) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is (1S,5S)-6-methoxy-3-azabicyclo[3.1.1]heptane-3-carboximidamide.
| Compound Name | (1S,5S)-6-methoxy-3-azabicyclo[3.1.1]heptane-3-carboximidamide |
|---|---|
| PubChem CID | 129495415 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (1S,5S)-6-methoxy-3-azabicyclo[3.1.1]heptane-3-carboximidamide |
| SMILES | [H]/N=C(\N)N1C[C@@H]2C[C@@H](C1)C2OC |
| InChI | InChI=1S/C8H15N3O/c1-12-7-5-2-6(7)4-11(3-5)8(9)10/h5-7H,2-4H2,1H3,(H3,9,10)/t5-,6-/m0/s1 |
| InChIKey | GYPZXAOZIUREAS-WDSKDSINSA-N |
| XLogP | -0.15 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|