C10H16F2N4 — CID 129497490
(3aR,7aS)-2-(2-azidoethyl)-7,7-difluoro-3,3a,4,5,6,7a-hexahydro-1H-isoindole (PubChem CID 129497490) has the molecular formula C10H16F2N4 and a molecular weight of 230.26 g/mol. Its IUPAC name is (3aR,7aS)-2-(2-azidoethyl)-7,7-difluoro-3,3a,4,5,6,7a-hexahydro-1H-isoindole.
| Compound Name | (3aR,7aS)-2-(2-azidoethyl)-7,7-difluoro-3,3a,4,5,6,7a-hexahydro-1H-isoindole |
|---|---|
| PubChem CID | 129497490 |
| Molecular Formula | C10H16F2N4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (3aR,7aS)-2-(2-azidoethyl)-7,7-difluoro-3,3a,4,5,6,7a-hexahydro-1H-isoindole |
| SMILES | [N-]=[N+]=NCCN1C[C@@H]2CCCC(F)(F)[C@@H]2C1 |
| InChI | InChI=1S/C10H16F2N4/c11-10(12)3-1-2-8-6-16(7-9(8)10)5-4-14-15-13/h8-9H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | MTGXRLGQNYVOTL-DTWKUNHWSA-N |
| XLogP | 2.66 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|