C9H16N4 — CID 130834832
3-(2-azidoethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane (PubChem CID 130834832) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(2-azidoethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-(2-azidoethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 130834832 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 3-(2-azidoethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane |
| SMILES | CC1(C)C2CN(CCN=[N+]=[N-])CC21 |
| InChI | InChI=1S/C9H16N4/c1-9(2)7-5-13(6-8(7)9)4-3-11-12-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | VAXOQGLSGZKINZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|