C7H16N6 — CID 158521253
1-(2-azidoethyl)-3,5-dimethyl-1,3,5-triazinane (PubChem CID 158521253) has the molecular formula C7H16N6 and a molecular weight of 184.25 g/mol. Its IUPAC name is 1-(2-azidoethyl)-3,5-dimethyl-1,3,5-triazinane.
| Compound Name | 1-(2-azidoethyl)-3,5-dimethyl-1,3,5-triazinane |
|---|---|
| PubChem CID | 158521253 |
| Molecular Formula | C7H16N6 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 1-(2-azidoethyl)-3,5-dimethyl-1,3,5-triazinane |
| SMILES | CN1CN(C)CN(CCN=[N+]=[N-])C1 |
| InChI | InChI=1S/C7H16N6/c1-11-5-12(2)7-13(6-11)4-3-9-10-8/h3-7H2,1-2H3 |
| InChIKey | NFKHXKFZDLLHIR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 58.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|