C10H20N4O — CID 129498350
(3S,4S)-1-(2-azidoethyl)-3-(ethoxymethyl)-4-methylpyrrolidine (PubChem CID 129498350) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is (3S,4S)-1-(2-azidoethyl)-3-(ethoxymethyl)-4-methylpyrrolidine.
| Compound Name | (3S,4S)-1-(2-azidoethyl)-3-(ethoxymethyl)-4-methylpyrrolidine |
|---|---|
| PubChem CID | 129498350 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (3S,4S)-1-(2-azidoethyl)-3-(ethoxymethyl)-4-methylpyrrolidine |
| SMILES | CCOC[C@@H]1CN(CCN=[N+]=[N-])C[C@H]1C |
| InChI | InChI=1S/C10H20N4O/c1-3-15-8-10-7-14(6-9(10)2)5-4-12-13-11/h9-10H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | HYUXHBQDFBDADH-ZJUUUORDSA-N |
| XLogP | 1.90 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|