About 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol
3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol (PubChem CID 130708552) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol |
| PubChem CID | 130708552 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol |
| SMILES | CC1(C)C2CN(CCCO)CC21 |
| InChI | InChI=1S/C10H19NO/c1-10(2)8-6-11(4-3-5-12)7-9(8)10/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | XITDDDPYFUKTTD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol?
The IUPAC name of 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol (CID 130708552) is 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol.
What is the SMILES notation for 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol?
The canonical SMILES for 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol is CC1(C)C2CN(CCCO)CC21.
What is the InChIKey of 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol?
The InChIKey is XITDDDPYFUKTTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-10(2)8-6-11(4-3-5-12)7-9(8)10/h8-9,12H,3-7H2,1-2H3.
What are the key properties of 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol?
3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol has a molecular weight of 169.27 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)propan-1-ol is sourced from PubChem (CID 130708552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).