C7H14N2O3S — CID 129497638
2-[(3aS)-1,1-dioxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazol-2-yl]ethanol (PubChem CID 129497638) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-[(3aS)-1,1-dioxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazol-2-yl]ethanol.
| Compound Name | 2-[(3aS)-1,1-dioxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 129497638 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-[(3aS)-1,1-dioxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazol-2-yl]ethanol |
| SMILES | O=S1(=O)N(CCO)C[C@@H]2CCCN21 |
| InChI | InChI=1S/C7H14N2O3S/c10-5-4-8-6-7-2-1-3-9(7)13(8,11)12/h7,10H,1-6H2/t7-/m0/s1 |
| InChIKey | BLCLSTMADFLAOQ-ZETCQYMHSA-N |
| XLogP | -1.00 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |