C6H7N3O2 — CID 129498729
(4S)-4-(1,3,4-oxadiazol-2-yl)pyrrolidin-2-one (PubChem CID 129498729) has the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. Its IUPAC name is (4S)-4-(1,3,4-oxadiazol-2-yl)pyrrolidin-2-one.
| Compound Name | (4S)-4-(1,3,4-oxadiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 129498729 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | (4S)-4-(1,3,4-oxadiazol-2-yl)pyrrolidin-2-one |
| SMILES | O=C1C[C@H](c2nnco2)CN1 |
| InChI | InChI=1S/C6H7N3O2/c10-5-1-4(2-7-5)6-9-8-3-11-6/h3-4H,1-2H2,(H,7,10)/t4-/m0/s1 |
| InChIKey | GOCIVSLGYNZJLZ-BYPYZUCNSA-N |
| XLogP | -0.33 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |