C10H15NO2 — CID 129499107
(6R)-3-ethyl-6-ethynyl-5,5-dimethyl-1,3-oxazinan-2-one (PubChem CID 129499107) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (6R)-3-ethyl-6-ethynyl-5,5-dimethyl-1,3-oxazinan-2-one.
| Compound Name | (6R)-3-ethyl-6-ethynyl-5,5-dimethyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 129499107 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (6R)-3-ethyl-6-ethynyl-5,5-dimethyl-1,3-oxazinan-2-one |
| SMILES | C#C[C@H]1OC(=O)N(CC)CC1(C)C |
| InChI | InChI=1S/C10H15NO2/c1-5-8-10(3,4)7-11(6-2)9(12)13-8/h1,8H,6-7H2,2-4H3/t8-/m1/s1 |
| InChIKey | IKSQHNYVIURELP-MRVPVSSYSA-N |
| XLogP | 1.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|