C18H20N4O2S2 — CID 12951597
5-[(4-methoxyphenyl)methyl]-2-[2-(1,2-thiazol-3-ylmethylsulfanyl)ethylamino]-1H-pyrimidin-6-one (PubChem CID 12951597) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-2-[2-(1,2-thiazol-3-ylmethylsulfanyl)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-2-[2-(1,2-thiazol-3-ylmethylsulfanyl)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 12951597 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-2-[2-(1,2-thiazol-3-ylmethylsulfanyl)ethylamino]-1H-pyrimidin-6-one |
| SMILES | COc1ccc(Cc2cnc(NCCSCc3ccsn3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H20N4O2S2/c1-24-16-4-2-13(3-5-16)10-14-11-20-18(21-17(14)23)19-7-9-25-12-15-6-8-26-22-15/h2-6,8,11H,7,9-10,12H2,1H3,(H2,19,20,21,23) |
| InChIKey | JUOJPKSDUODKRD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|