C19H23N5OS2 — CID 23346191
5-[(4-methoxyphenyl)methyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidine-6-thione (PubChem CID 23346191) has the molecular formula C19H23N5OS2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidine-6-thione.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidine-6-thione |
|---|---|
| PubChem CID | 23346191 |
| Molecular Formula | C19H23N5OS2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidine-6-thione |
| SMILES | COc1ccc(Cc2cnc(NCCSCc3nc[nH]c3C)[nH]c2=S)cc1 |
| InChI | InChI=1S/C19H23N5OS2/c1-13-17(23-12-22-13)11-27-8-7-20-19-21-10-15(18(26)24-19)9-14-3-5-16(25-2)6-4-14/h3-6,10,12H,7-9,11H2,1-2H3,(H,22,23)(H2,20,21,24,26) |
| InChIKey | MIOCBNXNWSCTNJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|