C19H21N3O — CID 12951899
N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide (PubChem CID 12951899) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide.
| Compound Name | N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide |
|---|---|
| PubChem CID | 12951899 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide |
| SMILES | CCC(=O)N(c1ccccc1)N(C1=NCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O/c1-2-19(23)22(17-12-7-4-8-13-17)21(18-14-9-15-20-18)16-10-5-3-6-11-16/h3-8,10-13H,2,9,14-15H2,1H3 |
| InChIKey | HBRXQWSCRMEVSJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|