About N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide
N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide (PubChem CID 12951899) has the molecular formula C19H21N3O
and a molecular weight of 307.40 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide.
Molecular Properties
| Compound Name | N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide |
| PubChem CID | 12951899 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide |
| SMILES | CCC(=O)N(c1ccccc1)N(C1=NCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O/c1-2-19(23)22(17-12-7-4-8-13-17)21(18-14-9-15-20-18)16-10-5-3-6-11-16/h3-8,10-13H,2,9,14-15H2,1H3 |
| InChIKey | HBRXQWSCRMEVSJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide?
The IUPAC name of N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide (CID 12951899) is N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide.
What is the SMILES notation for N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide?
The canonical SMILES for N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide is CCC(=O)N(c1ccccc1)N(C1=NCCC1)c1ccccc1.
What is the InChIKey of N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide?
The InChIKey is HBRXQWSCRMEVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O/c1-2-19(23)22(17-12-7-4-8-13-17)21(18-14-9-15-20-18)16-10-5-3-6-11-16/h3-8,10-13H,2,9,14-15H2,1H3.
What are the key properties of N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide?
N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide has a molecular weight of 307.40 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,4-dihydro-2H-pyrrol-5-yl)-N,N'-diphenylpropanehydrazide is sourced from PubChem (CID 12951899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).