C12H19NO2 — CID 12955696
ethyl 3-ethyl-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 12955696) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is ethyl 3-ethyl-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | ethyl 3-ethyl-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 12955696 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethyl 3-ethyl-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | CCOC(=O)N1C2C=CC(CC2)C1CC |
| InChI | InChI=1S/C12H19NO2/c1-3-11-9-5-7-10(8-6-9)13(11)12(14)15-4-2/h5,7,9-11H,3-4,6,8H2,1-2H3 |
| InChIKey | VYVILXNHDVGFAE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|