C12H16O4 — CID 12956254
methyl 5,5-dicyclopropyl-2-oxooxolane-3-carboxylate (PubChem CID 12956254) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl 5,5-dicyclopropyl-2-oxooxolane-3-carboxylate.
| Compound Name | methyl 5,5-dicyclopropyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 12956254 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methyl 5,5-dicyclopropyl-2-oxooxolane-3-carboxylate |
| SMILES | COC(=O)C1CC(C2CC2)(C2CC2)OC1=O |
| InChI | InChI=1S/C12H16O4/c1-15-10(13)9-6-12(7-2-3-7,8-4-5-8)16-11(9)14/h7-9H,2-6H2,1H3 |
| InChIKey | LYKRPXUOXRQUIY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|