C21H24FNO4 — CID 1295812
dimethyl 1-cyclohexyl-4-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 1295812) has the molecular formula C21H24FNO4 and a molecular weight of 373.42 g/mol. Its IUPAC name is dimethyl 1-cyclohexyl-4-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 1-cyclohexyl-4-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 1295812 |
| Molecular Formula | C21H24FNO4 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | dimethyl 1-cyclohexyl-4-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=CN(C2CCCCC2)C=C(C(=O)OC)C1c1cccc(F)c1 |
| InChI | InChI=1S/C21H24FNO4/c1-26-20(24)17-12-23(16-9-4-3-5-10-16)13-18(21(25)27-2)19(17)14-7-6-8-15(22)11-14/h6-8,11-13,16,19H,3-5,9-10H2,1-2H3 |
| InChIKey | QDWDUBCARJBUFL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |