C20H21N3O6 — CID 1295817
3-(4-nitrophenyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 1295817) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-nitrophenyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 1295817 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-(4-nitrophenyl)-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | CCOc1cc(-c2nc(-c3ccc([N+](=O)[O-])cc3)no2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H21N3O6/c1-4-26-16-11-14(12-17(27-5-2)18(16)28-6-3)20-21-19(22-29-20)13-7-9-15(10-8-13)23(24)25/h7-12H,4-6H2,1-3H3 |
| InChIKey | JVEAEMKSFHLKJY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 109.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|