C13H18N4O3Si — CID 12964285
1-(benzotriazol-1-ylmethyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane (PubChem CID 12964285) has the molecular formula C13H18N4O3Si and a molecular weight of 306.40 g/mol. Its IUPAC name is 1-(benzotriazol-1-ylmethyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane.
| Compound Name | 1-(benzotriazol-1-ylmethyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 12964285 |
| Molecular Formula | C13H18N4O3Si |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-(benzotriazol-1-ylmethyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
| SMILES | c1ccc2c(c1)nnn2C[Si]12OCCN(CCO1)CCO2 |
| InChI | InChI=1S/C13H18N4O3Si/c1-2-4-13-12(3-1)14-15-17(13)11-21-18-8-5-16(6-9-19-21)7-10-20-21/h1-4H,5-11H2 |
| InChIKey | JYEXZUDMFLZRQY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|