C9H11N3O2 — CID 66686231
3-(benzotriazol-1-yl)propane-1,1-diol (PubChem CID 66686231) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-(benzotriazol-1-yl)propane-1,1-diol.
| Compound Name | 3-(benzotriazol-1-yl)propane-1,1-diol |
|---|---|
| PubChem CID | 66686231 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-(benzotriazol-1-yl)propane-1,1-diol |
| SMILES | OC(O)CCn1nnc2ccccc21 |
| InChI | InChI=1S/C9H11N3O2/c13-9(14)5-6-12-8-4-2-1-3-7(8)10-11-12/h1-4,9,13-14H,5-6H2 |
| InChIKey | VJEFVEHNRRGNQX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|