About (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole
(7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole (PubChem CID 12965268) has the molecular formula C15H12F3NO
and a molecular weight of 279.26 g/mol. Its IUPAC name is (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole.
Molecular Properties
| Compound Name | (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole |
| PubChem CID | 12965268 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole |
| SMILES | FC(F)(F)c1onc2c1CCC/C2=C\c1ccccc1 |
| InChI | InChI=1S/C15H12F3NO/c16-15(17,18)14-12-8-4-7-11(13(12)19-20-14)9-10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2/b11-9+ |
| InChIKey | XOIDKJCPROVEIN-PKNBQFBNSA-N |
| XLogP | 4.57 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole?
The IUPAC name of (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole (CID 12965268) is (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole.
What is the SMILES notation for (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole?
The canonical SMILES for (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole is FC(F)(F)c1onc2c1CCC/C2=C\c1ccccc1.
What is the InChIKey of (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole?
The InChIKey is XOIDKJCPROVEIN-PKNBQFBNSA-N. The full InChI is InChI=1S/C15H12F3NO/c16-15(17,18)14-12-8-4-7-11(13(12)19-20-14)9-10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2/b11-9+.
What are the key properties of (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole?
(7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole has a molecular weight of 279.26 g/mol, XLogP of 4.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7E)-7-benzylidene-3-(trifluoromethyl)-5,6-dihydro-4H-2,1-benzoxazole is sourced from PubChem (CID 12965268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).