C16H12N2O3S — CID 12965865
2-[(ethenyl-oxo-phenyl-lambda6-sulfanylidene)amino]isoindole-1,3-dione (PubChem CID 12965865) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[(ethenyl-oxo-phenyl-lambda6-sulfanylidene)amino]isoindole-1,3-dione.
| Compound Name | 2-[(ethenyl-oxo-phenyl-lambda6-sulfanylidene)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 12965865 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-[(ethenyl-oxo-phenyl-lambda6-sulfanylidene)amino]isoindole-1,3-dione |
| SMILES | C=CS(=O)(=NN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C16H12N2O3S/c1-2-22(21,12-8-4-3-5-9-12)17-18-15(19)13-10-6-7-11-14(13)16(18)20/h2-11H,1H2 |
| InChIKey | YXRQMIAWJJZORP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|