C14H15NO3 — CID 12967753
methyl (4S,5S)-5-ethenyl-4-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 12967753) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl (4S,5S)-5-ethenyl-4-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4S,5S)-5-ethenyl-4-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 12967753 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | methyl (4S,5S)-5-ethenyl-4-methyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | C=C[C@@H]1OC(c2ccccc2)=N[C@]1(C)C(=O)OC |
| InChI | InChI=1S/C14H15NO3/c1-4-11-14(2,13(16)17-3)15-12(18-11)10-8-6-5-7-9-10/h4-9,11H,1H2,2-3H3/t11-,14-/m0/s1 |
| InChIKey | HXZBNRYRBPCOLH-FZMZJTMJSA-N |
| XLogP | 1.95 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|