C12H13NO2 — CID 12968367
3-ethoxy-5-methyl-4-phenyl-1,2-oxazole (PubChem CID 12968367) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-ethoxy-5-methyl-4-phenyl-1,2-oxazole.
| Compound Name | 3-ethoxy-5-methyl-4-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 12968367 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-ethoxy-5-methyl-4-phenyl-1,2-oxazole |
| SMILES | CCOc1noc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C12H13NO2/c1-3-14-12-11(9(2)15-13-12)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3 |
| InChIKey | NECKEUOMTKFPGD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |