About 1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene
1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene (PubChem CID 129690487) has the molecular formula C7H4F6
and a molecular weight of 202.10 g/mol. Its IUPAC name is 5,5,6-trifluoro-1-(trifluoromethyl)cyclohexa-1,3-diene.
Analyze 1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene?
The IUPAC name of 1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene (CID 129690487) is 5,5,6-trifluoro-1-(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene?
The canonical SMILES for 1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene is C1=CC(C(C(=C1)C(F)(F)F)F)(F)F.
What is the InChIKey of 1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene?
The InChIKey is UTQFDNMKVIQICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F6/c8-5-4(7(11,12)13)2-1-3-6(5,9)10/h1-3,5H.
What are the key properties of 1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene?
1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene has a molecular weight of 202.10 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Trifluoro-methyl-5,5,6-trifluoro-1,3-cyclohexadiene is sourced from PubChem (CID 129690487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).