C16H16ClFN2O2S — CID 1296959
1-(5-chloro-2,4-dimethoxyphenyl)-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 1296959) has the molecular formula C16H16ClFN2O2S and a molecular weight of 354.83 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 1296959 |
| Molecular Formula | C16H16ClFN2O2S |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | COc1cc(OC)c(NC(=S)NCc2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C16H16ClFN2O2S/c1-21-14-8-15(22-2)13(7-12(14)17)20-16(23)19-9-10-3-5-11(18)6-4-10/h3-8H,9H2,1-2H3,(H2,19,20,23) |
| InChIKey | IXEUBJPPVCDTMO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|