About S-benzyl dodecanethioate
S-benzyl dodecanethioate (PubChem CID 12969825) has the molecular formula C19H30OS
and a molecular weight of 306.51 g/mol. Its IUPAC name is S-benzyl dodecanethioate.
Molecular Properties
| Compound Name | S-benzyl dodecanethioate |
| PubChem CID | 12969825 |
| Molecular Formula | C19H30OS |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | S-benzyl dodecanethioate |
| SMILES | CCCCCCCCCCCC(=O)SCc1ccccc1 |
| InChI | InChI=1S/C19H30OS/c1-2-3-4-5-6-7-8-9-13-16-19(20)21-17-18-14-11-10-12-15-18/h10-12,14-15H,2-9,13,16-17H2,1H3 |
| InChIKey | VXPYPQZHBHLOLN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzyl dodecanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzyl dodecanethioate?
The IUPAC name of S-benzyl dodecanethioate (CID 12969825) is S-benzyl dodecanethioate.
What is the SMILES notation for S-benzyl dodecanethioate?
The canonical SMILES for S-benzyl dodecanethioate is CCCCCCCCCCCC(=O)SCc1ccccc1.
What is the InChIKey of S-benzyl dodecanethioate?
The InChIKey is VXPYPQZHBHLOLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30OS/c1-2-3-4-5-6-7-8-9-13-16-19(20)21-17-18-14-11-10-12-15-18/h10-12,14-15H,2-9,13,16-17H2,1H3.
What are the key properties of S-benzyl dodecanethioate?
S-benzyl dodecanethioate has a molecular weight of 306.51 g/mol, XLogP of 6.37, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzyl dodecanethioate is sourced from PubChem (CID 12969825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).