C16H13N3O3 — CID 12972530
ethyl 4-oxo-1-pyridin-3-yl-1,8-naphthyridine-3-carboxylate (PubChem CID 12972530) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is ethyl 4-oxo-1-pyridin-3-yl-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 4-oxo-1-pyridin-3-yl-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 12972530 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | ethyl 4-oxo-1-pyridin-3-yl-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cccnc2)c2ncccc2c1=O |
| InChI | InChI=1S/C16H13N3O3/c1-2-22-16(21)13-10-19(11-5-3-7-17-9-11)15-12(14(13)20)6-4-8-18-15/h3-10H,2H2,1H3 |
| InChIKey | ZCNYBOZJXOSSDY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |