C19H20N4O4 — CID 68583605
ethyl 2-(2-methoxyethylamino)-5-oxo-8-phenylpyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 68583605) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 2-(2-methoxyethylamino)-5-oxo-8-phenylpyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-(2-methoxyethylamino)-5-oxo-8-phenylpyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 68583605 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | ethyl 2-(2-methoxyethylamino)-5-oxo-8-phenylpyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccccc2)c2nc(NCCOC)ncc2c1=O |
| InChI | InChI=1S/C19H20N4O4/c1-3-27-18(25)15-12-23(13-7-5-4-6-8-13)17-14(16(15)24)11-21-19(22-17)20-9-10-26-2/h4-8,11-12H,3,9-10H2,1-2H3,(H,20,21,22) |
| InChIKey | UYKPVNLWIDODCC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|