C11H11N — CID 129776972
Tetrahydrodicyclopenta-[b,e]pyridine (PubChem CID 129776972) has the molecular formula C11H11N and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-azatricyclo[7.3.0.03,7]dodeca-1,7,9,11-tetraene.
| Compound Name | Tetrahydrodicyclopenta-[b,e]pyridine |
|---|---|
| PubChem CID | 129776972 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-azatricyclo[7.3.0.03,7]dodeca-1,7,9,11-tetraene |
| SMILES | C1CC2C(=CC3=CC=CC3=N2)C1 |
| InChI | InChI=1S/C11H11N/c1-3-8-7-9-4-2-6-11(9)12-10(8)5-1/h1,3,5,7,11H,2,4,6H2 |
| InChIKey | YPZDGNIMPOFCQP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | 342 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |