C22H20N2O7 — CID 1298115
dimethyl 1-(4-methoxyphenyl)-4-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 1298115) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is dimethyl 1-(4-methoxyphenyl)-4-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 1-(4-methoxyphenyl)-4-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 1298115 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | dimethyl 1-(4-methoxyphenyl)-4-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=CN(c2ccc(OC)cc2)C=C(C(=O)OC)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N2O7/c1-29-17-10-8-15(9-11-17)23-12-18(21(25)30-2)20(19(13-23)22(26)31-3)14-4-6-16(7-5-14)24(27)28/h4-13,20H,1-3H3 |
| InChIKey | PINIIDDAOCHTPB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|