C15H12Br2F2O2 — CID 12982381
(1R,3R)-1,3-bis(4-bromophenyl)-2,2-difluoropropane-1,3-diol (PubChem CID 12982381) has the molecular formula C15H12Br2F2O2 and a molecular weight of 422.06 g/mol. Its IUPAC name is (1R,3R)-1,3-bis(4-bromophenyl)-2,2-difluoropropane-1,3-diol.
| Compound Name | (1R,3R)-1,3-bis(4-bromophenyl)-2,2-difluoropropane-1,3-diol |
|---|---|
| PubChem CID | 12982381 |
| Molecular Formula | C15H12Br2F2O2 |
| Molecular Weight | 422.06 g/mol |
| Exact Mass | 419.92 |
| IUPAC Name | (1R,3R)-1,3-bis(4-bromophenyl)-2,2-difluoropropane-1,3-diol |
| SMILES | O[C@H](c1ccc(Br)cc1)C(F)(F)[C@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12Br2F2O2/c16-11-5-1-9(2-6-11)13(20)15(18,19)14(21)10-3-7-12(17)8-4-10/h1-8,13-14,20-21H/t13-,14-/m1/s1 |
| InChIKey | XUWPUDPKJOJJLT-ZIAGYGMSSA-N |
| XLogP | 4.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.06 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |