C28H27NO4 — CID 12983124
dimethyl 22-ethyl-22-azapentacyclo[14.2.2.14,8.17,10.19,13]tricosa-1(18),4(23),5,7,9,11,13(21),16,19-nonaene-17,19-dicarboxylate (PubChem CID 12983124) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is dimethyl 22-ethyl-22-azapentacyclo[14.2.2.14,8.17,10.19,13]tricosa-1(18),4(23),5,7,9,11,13(21),16,19-nonaene-17,19-dicarboxylate.
| Compound Name | dimethyl 22-ethyl-22-azapentacyclo[14.2.2.14,8.17,10.19,13]tricosa-1(18),4(23),5,7,9,11,13(21),16,19-nonaene-17,19-dicarboxylate |
|---|---|
| PubChem CID | 12983124 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | dimethyl 22-ethyl-22-azapentacyclo[14.2.2.14,8.17,10.19,13]tricosa-1(18),4(23),5,7,9,11,13(21),16,19-nonaene-17,19-dicarboxylate |
| SMILES | CCn1c2ccc3cc2c2cc(ccc21)CCc1cc(C(=O)OC)c(cc1C(=O)OC)CC3 |
| InChI | InChI=1S/C28H27NO4/c1-4-29-25-11-7-17-5-9-19-16-22(28(31)33-3)20(15-21(19)27(30)32-2)10-6-18-8-12-26(29)24(14-18)23(25)13-17/h7-8,11-16H,4-6,9-10H2,1-3H3 |
| InChIKey | SNYUZNFIADJAHY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |