C19H24O4 — CID 12985712
(8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-trione (PubChem CID 12985712) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-trione.
| Compound Name | (8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-trione |
|---|---|
| PubChem CID | 12985712 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-trione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC(=O)C4=CC(=O)CC[C@@]43CO)[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H24O4/c1-18-6-5-14-12(13(18)2-3-17(18)23)9-16(22)15-8-11(21)4-7-19(14,15)10-20/h8,12-14,20H,2-7,9-10H2,1H3/t12-,13-,14-,18-,19-/m0/s1 |
| InChIKey | FTEXDSIFOKVASF-JELDOXETSA-N |
| XLogP | 2.24 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |