C19H26O5 — CID 174354224
(8R,9S,10R,13S,14S)-1-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-trione;hydrate (PubChem CID 174354224) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-1-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-trione;hydrate.
| Compound Name | (8R,9S,10R,13S,14S)-1-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-trione;hydrate |
|---|---|
| PubChem CID | 174354224 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (8R,9S,10R,13S,14S)-1-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-trione;hydrate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC(=O)C4=CC(=O)CC(O)[C@@]43C)[C@@H]1CCC2=O.O |
| InChI | InChI=1S/C19H24O4.H2O/c1-18-6-5-13-11(12(18)3-4-16(18)22)9-15(21)14-7-10(20)8-17(23)19(13,14)2;/h7,11-13,17,23H,3-6,8-9H2,1-2H3;1H2/t11-,12-,13-,17?,18-,19+;/m0./s1 |
| InChIKey | HQWBKJSECBEQTQ-PHFXLJOASA-N |
| XLogP | 1.41 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |