About propan-2-yl (propan-2-yloxycarbonylamino) carbonate
propan-2-yl (propan-2-yloxycarbonylamino) carbonate (PubChem CID 12985743) has the molecular formula C8H15NO5
and a molecular weight of 205.21 g/mol. Its IUPAC name is propan-2-yl (propan-2-yloxycarbonylamino) carbonate.
Molecular Properties
| Compound Name | propan-2-yl (propan-2-yloxycarbonylamino) carbonate |
| PubChem CID | 12985743 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | propan-2-yl (propan-2-yloxycarbonylamino) carbonate |
| SMILES | CC(C)OC(=O)NOC(=O)OC(C)C |
| InChI | InChI=1S/C8H15NO5/c1-5(2)12-7(10)9-14-8(11)13-6(3)4/h5-6H,1-4H3,(H,9,10) |
| InChIKey | PFHHQCRTDDVBQS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (propan-2-yloxycarbonylamino) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (propan-2-yloxycarbonylamino) carbonate?
The IUPAC name of propan-2-yl (propan-2-yloxycarbonylamino) carbonate (CID 12985743) is propan-2-yl (propan-2-yloxycarbonylamino) carbonate.
What is the SMILES notation for propan-2-yl (propan-2-yloxycarbonylamino) carbonate?
The canonical SMILES for propan-2-yl (propan-2-yloxycarbonylamino) carbonate is CC(C)OC(=O)NOC(=O)OC(C)C.
What is the InChIKey of propan-2-yl (propan-2-yloxycarbonylamino) carbonate?
The InChIKey is PFHHQCRTDDVBQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO5/c1-5(2)12-7(10)9-14-8(11)13-6(3)4/h5-6H,1-4H3,(H,9,10).
What are the key properties of propan-2-yl (propan-2-yloxycarbonylamino) carbonate?
propan-2-yl (propan-2-yloxycarbonylamino) carbonate has a molecular weight of 205.21 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (propan-2-yloxycarbonylamino) carbonate is sourced from PubChem (CID 12985743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).