C21H19Cl2NO7 — CID 12987462
dimethyl (3R,4R,5R)-3-(3,4-dichlorophenyl)-5-(4-methylphenyl)-4-nitrooxolane-2,2-dicarboxylate (PubChem CID 12987462) has the molecular formula C21H19Cl2NO7 and a molecular weight of 468.29 g/mol. Its IUPAC name is dimethyl (3R,4R,5R)-3-(3,4-dichlorophenyl)-5-(4-methylphenyl)-4-nitrooxolane-2,2-dicarboxylate.
| Compound Name | dimethyl (3R,4R,5R)-3-(3,4-dichlorophenyl)-5-(4-methylphenyl)-4-nitrooxolane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 12987462 |
| Molecular Formula | C21H19Cl2NO7 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | dimethyl (3R,4R,5R)-3-(3,4-dichlorophenyl)-5-(4-methylphenyl)-4-nitrooxolane-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)O[C@H](c2ccc(C)cc2)[C@H]([N+](=O)[O-])[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2NO7/c1-11-4-6-12(7-5-11)18-17(24(27)28)16(13-8-9-14(22)15(23)10-13)21(31-18,19(25)29-2)20(26)30-3/h4-10,16-18H,1-3H3/t16-,17-,18-/m1/s1 |
| InChIKey | UMNADHYIPODPNG-KZNAEPCWSA-N |
| XLogP | 3.89 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|