C20H18ClNO7 — CID 101340787
dimethyl (3R,4R,5R)-3-(4-chlorophenyl)-4-nitro-5-phenyloxolane-2,2-dicarboxylate (PubChem CID 101340787) has the molecular formula C20H18ClNO7 and a molecular weight of 419.82 g/mol. Its IUPAC name is dimethyl (3R,4R,5R)-3-(4-chlorophenyl)-4-nitro-5-phenyloxolane-2,2-dicarboxylate.
| Compound Name | dimethyl (3R,4R,5R)-3-(4-chlorophenyl)-4-nitro-5-phenyloxolane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101340787 |
| Molecular Formula | C20H18ClNO7 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | dimethyl (3R,4R,5R)-3-(4-chlorophenyl)-4-nitro-5-phenyloxolane-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)O[C@H](c2ccccc2)[C@H]([N+](=O)[O-])[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO7/c1-27-18(23)20(19(24)28-2)15(12-8-10-14(21)11-9-12)16(22(25)26)17(29-20)13-6-4-3-5-7-13/h3-11,15-17H,1-2H3/t15-,16-,17-/m1/s1 |
| InChIKey | GFJRWDQDJFJXLM-BRWVUGGUSA-N |
| XLogP | 2.93 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|