C26H23NO5 — CID 163491506
methyl (2S,3S,4S,5S)-4-nitro-2,3-diphenyl-5-[(E)-2-phenylethenyl]oxolane-2-carboxylate (PubChem CID 163491506) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is methyl (2S,3S,4S,5S)-4-nitro-2,3-diphenyl-5-[(E)-2-phenylethenyl]oxolane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5S)-4-nitro-2,3-diphenyl-5-[(E)-2-phenylethenyl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 163491506 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | methyl (2S,3S,4S,5S)-4-nitro-2,3-diphenyl-5-[(E)-2-phenylethenyl]oxolane-2-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)O[C@@H](/C=C/c2ccccc2)[C@@H]([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H23NO5/c1-31-25(28)26(21-15-9-4-10-16-21)23(20-13-7-3-8-14-20)24(27(29)30)22(32-26)18-17-19-11-5-2-6-12-19/h2-18,22-24H,1H3/b18-17+/t22-,23-,24+,26+/m0/s1 |
| InChIKey | CNAHPRKMZYNSAW-XVAQPXIUSA-N |
| XLogP | 4.60 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|